/chembl_multitask_model

Target prediction multitask neural network, with examples running it in Python, C++, Julia and JS

Primary LanguagePython

ChEMBL Multitask Nerual Network model

The model is exported to the ONNX format so it can be used in any programming language able to generate fingerprints with RDKit

Example to predict in Python using the ONNX Runtime

import onnxruntime
import numpy as np
from rdkit import Chem
from rdkit.Chem import rdMolDescriptors

FP_SIZE = 1024
RADIUS = 2

def calc_morgan_fp(smiles):
    mol = Chem.MolFromSmiles(smiles)
    fp = rdMolDescriptors.GetMorganFingerprintAsBitVect(
        mol, RADIUS, nBits=FP_SIZE)
    a = np.zeros((0,), dtype=np.float32)
    Chem.DataStructs.ConvertToNumpyArray(fp, a)
    return a

def format_preds(preds, targets):
    preds = np.concatenate(preds).ravel()
    np_preds = [(tar, pre) for tar, pre in zip(targets, preds)]
    dt = [('chembl_id','|U20'), ('pred', '<f4')]
    np_preds = np.array(np_preds, dtype=dt)
    np_preds[::-1].sort(order='pred')
    return np_preds

# load the model
ort_session = onnxruntime.InferenceSession("trained_models/chembl_33_model/chembl_33_multitask.onnx", providers=['CPUExecutionProvider'])

# calculate the FPs
smiles = 'CN(C)CCc1c[nH]c2ccc(C[C@H]3COC(=O)N3)cc12'
descs = calc_morgan_fp(smiles)

# run the prediction
ort_inputs = {ort_session.get_inputs()[0].name: descs}
preds = ort_session.run(None, ort_inputs)

# example of how the output of the model can be formatted
preds = format_preds(preds, [o.name for o in ort_session.get_outputs()])

In Julia using RDKitMinimalLib.jl and ONNX.jl

import RDKitMinimalLib: get_mol, get_morgan_fp
import Umlaut: play!
import ONNX
import JSON

path = "chembl_31_multitask.onnx"
targets = JSON.parsefile("targets_31.json")

# dummy input
dummy = rand(Float32, 1024, 1)
# load the model
mt_chembl = ONNX.load(path, dummy)

# load molecule and calc morgan fingerprint
mol = get_mol("CC(=O)Oc1ccccc1C(=O)O")
fp_details = Dict{String, Any}("nBits" => 1024, "radius" => 2)
mfp = get_morgan_fp(mol, fp_details)

# convert the bitstring to a 1024×1 Matrix{Float32}
mfp = map(x->parse(Float32,string(x)),collect(mfp))
mfp = reshape(mfp, (length(mfp), 1))

# test a molecule
pred = play!(mt_chembl, mfp)
pred = collect(Iterators.flatten(pred))

res = tuple.(targets, pred)
res = sort(res, by=res->res[2], rev=true)

C++ REST microservice

https://github.com/eloyfelix/pistache_predictor

Try it online!

Using both RDKit Javascript MinimalLib and ONNX.js. Hosted in github pages: https://chembl.github.io/chembl_multitask_model